C13H17NO5 — CID 63704808
2-[acetyl(methyl)amino]-2-(2,3-dimethoxyphenyl)acetic acid (PubChem CID 63704808) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[acetyl(methyl)amino]-2-(2,3-dimethoxyphenyl)acetic acid.
| Compound Name | 2-[acetyl(methyl)amino]-2-(2,3-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 63704808 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[acetyl(methyl)amino]-2-(2,3-dimethoxyphenyl)acetic acid |
| SMILES | COc1cccc(C(C(=O)O)N(C)C(C)=O)c1OC |
| InChI | InChI=1S/C13H17NO5/c1-8(15)14(2)11(13(16)17)9-6-5-7-10(18-3)12(9)19-4/h5-7,11H,1-4H3,(H,16,17) |
| InChIKey | ATJSNYSCCGBEJU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |