About 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid
2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid (PubChem CID 63701401) has the molecular formula C11H11F2NO3
and a molecular weight of 243.21 g/mol. Its IUPAC name is 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid.
Molecular Properties
| Compound Name | 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid |
| PubChem CID | 63701401 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid |
| SMILES | CC(=O)N(C)C(C(=O)O)c1cccc(F)c1F |
| InChI | InChI=1S/C11H11F2NO3/c1-6(15)14(2)10(11(16)17)7-4-3-5-8(12)9(7)13/h3-5,10H,1-2H3,(H,16,17) |
| InChIKey | CYGCFSFNJZUSBW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid?
The IUPAC name of 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid (CID 63701401) is 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid.
What is the SMILES notation for 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid?
The canonical SMILES for 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid is CC(=O)N(C)C(C(=O)O)c1cccc(F)c1F.
What is the InChIKey of 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid?
The InChIKey is CYGCFSFNJZUSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO3/c1-6(15)14(2)10(11(16)17)7-4-3-5-8(12)9(7)13/h3-5,10H,1-2H3,(H,16,17).
What are the key properties of 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid?
2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid has a molecular weight of 243.21 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[acetyl(methyl)amino]-2-(2,3-difluorophenyl)acetic acid is sourced from PubChem (CID 63701401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).