C10H11FO5 — CID 117331953
2-(3-fluoro-2,4-dimethoxyphenyl)-2-hydroxyacetic acid (PubChem CID 117331953) has the molecular formula C10H11FO5 and a molecular weight of 230.19 g/mol. Its IUPAC name is 2-(3-fluoro-2,4-dimethoxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(3-fluoro-2,4-dimethoxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117331953 |
| Molecular Formula | C10H11FO5 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-(3-fluoro-2,4-dimethoxyphenyl)-2-hydroxyacetic acid |
| SMILES | COc1ccc(C(O)C(=O)O)c(OC)c1F |
| InChI | InChI=1S/C10H11FO5/c1-15-6-4-3-5(8(12)10(13)14)9(16-2)7(6)11/h3-4,8,12H,1-2H3,(H,13,14) |
| InChIKey | VHPBBZXMJNGBMD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |