C11H13FO5 — CID 117361997
methyl 2-(3-fluoro-2,4-dimethoxyphenyl)-2-hydroxyacetate (PubChem CID 117361997) has the molecular formula C11H13FO5 and a molecular weight of 244.22 g/mol. Its IUPAC name is methyl 2-(3-fluoro-2,4-dimethoxyphenyl)-2-hydroxyacetate.
| Compound Name | methyl 2-(3-fluoro-2,4-dimethoxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117361997 |
| Molecular Formula | C11H13FO5 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | methyl 2-(3-fluoro-2,4-dimethoxyphenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1ccc(OC)c(F)c1OC |
| InChI | InChI=1S/C11H13FO5/c1-15-7-5-4-6(9(13)11(14)17-3)10(16-2)8(7)12/h4-5,9,13H,1-3H3 |
| InChIKey | CWMIUOOMSRYLMU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |