C10H9BrF2O4 — CID 117495753
methyl 2-(5-bromo-3,4-difluoro-2-methoxyphenyl)-2-hydroxyacetate (PubChem CID 117495753) has the molecular formula C10H9BrF2O4 and a molecular weight of 311.08 g/mol. Its IUPAC name is methyl 2-(5-bromo-3,4-difluoro-2-methoxyphenyl)-2-hydroxyacetate.
| Compound Name | methyl 2-(5-bromo-3,4-difluoro-2-methoxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117495753 |
| Molecular Formula | C10H9BrF2O4 |
| Molecular Weight | 311.08 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | methyl 2-(5-bromo-3,4-difluoro-2-methoxyphenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1cc(Br)c(F)c(F)c1OC |
| InChI | InChI=1S/C10H9BrF2O4/c1-16-9-4(8(14)10(15)17-2)3-5(11)6(12)7(9)13/h3,8,14H,1-2H3 |
| InChIKey | GCSJXEMXXGHCDJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.08 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|