methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate

C9H8BrFO3 — CID 103946884

IUPACmethyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate
SMILESCOC(=O)C(O)c1cc(F)ccc1Br
InChIInChI=1S/C9H8BrFO3/c1-14-9(13)8(12)6-4-5(11)2-3-7(6)10/h2-4,8,12H,1H3
InChIKeyRTPHSEFJCSAGOZ-UHFFFAOYSA-N
MW263.06 g/mol
LogP1.79
Rot. Bonds2

About methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate

methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate (PubChem CID 103946884) has the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. Its IUPAC name is methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate.

Molecular Properties

Compound Namemethyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate
PubChem CID103946884
Molecular FormulaC9H8BrFO3
Molecular Weight263.06 g/mol
Exact Mass261.96
IUPAC Namemethyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate
SMILESCOC(=O)C(O)c1cc(F)ccc1Br
InChIInChI=1S/C9H8BrFO3/c1-14-9(13)8(12)6-4-5(11)2-3-7(6)10/h2-4,8,12H,1H3
InChIKeyRTPHSEFJCSAGOZ-UHFFFAOYSA-N
XLogP1.79
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.06
LogP ≤ 51.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate?
The IUPAC name of methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate (CID 103946884) is methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate.
What is the SMILES notation for methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate?
The canonical SMILES for methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate is COC(=O)C(O)c1cc(F)ccc1Br.
What is the InChIKey of methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate?
The InChIKey is RTPHSEFJCSAGOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrFO3/c1-14-9(13)8(12)6-4-5(11)2-3-7(6)10/h2-4,8,12H,1H3.
What are the key properties of methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate?
methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate has a molecular weight of 263.06 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-bromo-5-fluorophenyl)-2-hydroxyacetate is sourced from PubChem (CID 103946884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).