C11H16FNO2 — CID 84782781
2-(3-fluoro-2,4-dimethoxyphenyl)propan-1-amine (PubChem CID 84782781) has the molecular formula C11H16FNO2 and a molecular weight of 213.25 g/mol. Its IUPAC name is 2-(3-fluoro-2,4-dimethoxyphenyl)propan-1-amine.
| Compound Name | 2-(3-fluoro-2,4-dimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 84782781 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-(3-fluoro-2,4-dimethoxyphenyl)propan-1-amine |
| SMILES | COc1ccc(C(C)CN)c(OC)c1F |
| InChI | InChI=1S/C11H16FNO2/c1-7(6-13)8-4-5-9(14-2)10(12)11(8)15-3/h4-5,7H,6,13H2,1-3H3 |
| InChIKey | OSIDYFYWAKMELU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |