About methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate
methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate (PubChem CID 117409610) has the molecular formula C11H12F2O5
and a molecular weight of 262.21 g/mol. Its IUPAC name is methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate.
Analyze methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate?
The IUPAC name of methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate (CID 117409610) is methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate.
What is the SMILES notation for methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate?
The canonical SMILES for methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate is COC(=O)C(O)c1c(F)c(OC)cc(OC)c1F.
What is the InChIKey of methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate?
The InChIKey is OLUOXUCZMQVMOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O5/c1-16-5-4-6(17-2)9(13)7(8(5)12)10(14)11(15)18-3/h4,10,14H,1-3H3.
What are the key properties of methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate?
methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate has a molecular weight of 262.21 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,6-difluoro-3,5-dimethoxyphenyl)-2-hydroxyacetate is sourced from PubChem (CID 117409610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).