C12H15ClO6 — CID 117469723
methyl 2-(6-chloro-2,3,4-trimethoxyphenyl)-2-hydroxyacetate (PubChem CID 117469723) has the molecular formula C12H15ClO6 and a molecular weight of 290.70 g/mol. Its IUPAC name is methyl 2-(6-chloro-2,3,4-trimethoxyphenyl)-2-hydroxyacetate.
| Compound Name | methyl 2-(6-chloro-2,3,4-trimethoxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117469723 |
| Molecular Formula | C12H15ClO6 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | methyl 2-(6-chloro-2,3,4-trimethoxyphenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1c(Cl)cc(OC)c(OC)c1OC |
| InChI | InChI=1S/C12H15ClO6/c1-16-7-5-6(13)8(9(14)12(15)19-4)11(18-3)10(7)17-2/h5,9,14H,1-4H3 |
| InChIKey | UHNRAMYUGJVONR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |