C11H13ClO6 — CID 117443259
2-(2-chloro-3,4,6-trimethoxyphenyl)-2-hydroxyacetic acid (PubChem CID 117443259) has the molecular formula C11H13ClO6 and a molecular weight of 276.67 g/mol. Its IUPAC name is 2-(2-chloro-3,4,6-trimethoxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2-chloro-3,4,6-trimethoxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117443259 |
| Molecular Formula | C11H13ClO6 |
| Molecular Weight | 276.67 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-(2-chloro-3,4,6-trimethoxyphenyl)-2-hydroxyacetic acid |
| SMILES | COc1cc(OC)c(C(O)C(=O)O)c(Cl)c1OC |
| InChI | InChI=1S/C11H13ClO6/c1-16-5-4-6(17-2)10(18-3)8(12)7(5)9(13)11(14)15/h4,9,13H,1-3H3,(H,14,15) |
| InChIKey | PUEOCPREQVWYCV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.67 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |