C12H16ClNO5 — CID 117467974
3-amino-3-(2-chloro-3,4,6-trimethoxyphenyl)propanoic acid (PubChem CID 117467974) has the molecular formula C12H16ClNO5 and a molecular weight of 289.72 g/mol. Its IUPAC name is 3-amino-3-(2-chloro-3,4,6-trimethoxyphenyl)propanoic acid.
| Compound Name | 3-amino-3-(2-chloro-3,4,6-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117467974 |
| Molecular Formula | C12H16ClNO5 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3-amino-3-(2-chloro-3,4,6-trimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(OC)c(C(N)CC(=O)O)c(Cl)c1OC |
| InChI | InChI=1S/C12H16ClNO5/c1-17-7-5-8(18-2)12(19-3)11(13)10(7)6(14)4-9(15)16/h5-6H,4,14H2,1-3H3,(H,15,16) |
| InChIKey | GUIKZOXMUHMJAP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |