2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid

C9H7ClF2O4 — CID 117384549

IUPAC2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid
SMILESCOc1cc(F)c(C(O)C(=O)O)c(F)c1Cl
InChIInChI=1S/C9H7ClF2O4/c1-16-4-2-3(11)5(7(12)6(4)10)8(13)9(14)15/h2,8,13H,1H3,(H,14,15)
InChIKeyAUZBIUFLSMHZBC-UHFFFAOYSA-N
MW252.60 g/mol
LogP1.74
Rot. Bonds3

About 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid

2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid (PubChem CID 117384549) has the molecular formula C9H7ClF2O4 and a molecular weight of 252.60 g/mol. Its IUPAC name is 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid
PubChem CID117384549
Molecular FormulaC9H7ClF2O4
Molecular Weight252.60 g/mol
Exact Mass252.00
IUPAC Name2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid
SMILESCOc1cc(F)c(C(O)C(=O)O)c(F)c1Cl
InChIInChI=1S/C9H7ClF2O4/c1-16-4-2-3(11)5(7(12)6(4)10)8(13)9(14)15/h2,8,13H,1H3,(H,14,15)
InChIKeyAUZBIUFLSMHZBC-UHFFFAOYSA-N
XLogP1.74
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.60
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid?
The IUPAC name of 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid (CID 117384549) is 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid.
What is the SMILES notation for 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid?
The canonical SMILES for 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid is COc1cc(F)c(C(O)C(=O)O)c(F)c1Cl.
What is the InChIKey of 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid?
The InChIKey is AUZBIUFLSMHZBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClF2O4/c1-16-4-2-3(11)5(7(12)6(4)10)8(13)9(14)15/h2,8,13H,1H3,(H,14,15).
What are the key properties of 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid?
2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid has a molecular weight of 252.60 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid is sourced from PubChem (CID 117384549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).