C10H10F2O5 — CID 170825291
3-(2,6-difluoro-4-methoxyphenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170825291) has the molecular formula C10H10F2O5 and a molecular weight of 248.18 g/mol. Its IUPAC name is 3-(2,6-difluoro-4-methoxyphenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(2,6-difluoro-4-methoxyphenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170825291 |
| Molecular Formula | C10H10F2O5 |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-(2,6-difluoro-4-methoxyphenyl)-2,3-dihydroxypropanoic acid |
| SMILES | COc1cc(F)c(C(O)C(O)C(=O)O)c(F)c1 |
| InChI | InChI=1S/C10H10F2O5/c1-17-4-2-5(11)7(6(12)3-4)8(13)9(14)10(15)16/h2-3,8-9,13-14H,1H3,(H,15,16) |
| InChIKey | WMEGAKNPKCBHSM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |