C13H18F2O2 — CID 61100809
1-(2,6-difluoro-4-methoxyphenyl)-4-methylpentan-1-ol (PubChem CID 61100809) has the molecular formula C13H18F2O2 and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-methoxyphenyl)-4-methylpentan-1-ol.
| Compound Name | 1-(2,6-difluoro-4-methoxyphenyl)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 61100809 |
| Molecular Formula | C13H18F2O2 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-(2,6-difluoro-4-methoxyphenyl)-4-methylpentan-1-ol |
| SMILES | COc1cc(F)c(C(O)CCC(C)C)c(F)c1 |
| InChI | InChI=1S/C13H18F2O2/c1-8(2)4-5-12(16)13-10(14)6-9(17-3)7-11(13)15/h6-8,12,16H,4-5H2,1-3H3 |
| InChIKey | WLGIHRXVHFTCDO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |