C16H27NO4 — CID 171267047
(1S,2R)-1-amino-5-methyl-1-(2,4,6-trimethoxyphenyl)hexan-2-ol (PubChem CID 171267047) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1S,2R)-1-amino-5-methyl-1-(2,4,6-trimethoxyphenyl)hexan-2-ol.
| Compound Name | (1S,2R)-1-amino-5-methyl-1-(2,4,6-trimethoxyphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 171267047 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (1S,2R)-1-amino-5-methyl-1-(2,4,6-trimethoxyphenyl)hexan-2-ol |
| SMILES | COc1cc(OC)c([C@H](N)[C@H](O)CCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C16H27NO4/c1-10(2)6-7-12(18)16(17)15-13(20-4)8-11(19-3)9-14(15)21-5/h8-10,12,16,18H,6-7,17H2,1-5H3/t12-,16-/m1/s1 |
| InChIKey | FPZPHKIKEKAQCE-MLGOLLRUSA-N |
| XLogP | 2.51 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |