C14H24ClNO4 — CID 171263081
4-[(1R,2S)-1-amino-2-hydroxyhexyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171263081) has the molecular formula C14H24ClNO4 and a molecular weight of 305.80 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxyhexyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxyhexyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171263081 |
| Molecular Formula | C14H24ClNO4 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxyhexyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | CCCC[C@H](O)[C@H](N)c1c(OC)cc(O)cc1OC.Cl |
| InChI | InChI=1S/C14H23NO4.ClH/c1-4-5-6-10(17)14(15)13-11(18-2)7-9(16)8-12(13)19-3;/h7-8,10,14,16-17H,4-6,15H2,1-3H3;1H/t10-,14-;/m0./s1 |
| InChIKey | GKVBJOCMXGKUME-LPJGFKLNSA-N |
| XLogP | 2.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |