C12H19NO4 — CID 171268735
4-[(1S,2R)-1-amino-2-hydroxybutyl]-3,5-dimethoxyphenol (PubChem CID 171268735) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[(1S,2R)-1-amino-2-hydroxybutyl]-3,5-dimethoxyphenol.
| Compound Name | 4-[(1S,2R)-1-amino-2-hydroxybutyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171268735 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-[(1S,2R)-1-amino-2-hydroxybutyl]-3,5-dimethoxyphenol |
| SMILES | CC[C@@H](O)[C@@H](N)c1c(OC)cc(O)cc1OC |
| InChI | InChI=1S/C12H19NO4/c1-4-8(15)12(13)11-9(16-2)5-7(14)6-10(11)17-3/h5-6,8,12,14-15H,4,13H2,1-3H3/t8-,12-/m1/s1 |
| InChIKey | SAKNQTCZKDLJMT-PRHODGIISA-N |
| XLogP | 1.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |