C12H19NO3 — CID 171267082
(1S,2R)-1-amino-1-(2,6-dimethoxyphenyl)butan-2-ol (PubChem CID 171267082) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,6-dimethoxyphenyl)butan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2,6-dimethoxyphenyl)butan-2-ol |
|---|---|
| PubChem CID | 171267082 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,6-dimethoxyphenyl)butan-2-ol |
| SMILES | CC[C@@H](O)[C@@H](N)c1c(OC)cccc1OC |
| InChI | InChI=1S/C12H19NO3/c1-4-8(14)12(13)11-9(15-2)6-5-7-10(11)16-3/h5-8,12,14H,4,13H2,1-3H3/t8-,12-/m1/s1 |
| InChIKey | JXVJDQSIHBTZRG-PRHODGIISA-N |
| XLogP | 1.47 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |