C13H22ClNO3 — CID 171271799
2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]-3-methoxyphenol;hydrochloride (PubChem CID 171271799) has the molecular formula C13H22ClNO3 and a molecular weight of 275.78 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]-3-methoxyphenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]-3-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171271799 |
| Molecular Formula | C13H22ClNO3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]-3-methoxyphenol;hydrochloride |
| SMILES | CCC(C)[C@@H](O)[C@@H](N)c1c(O)cccc1OC.Cl |
| InChI | InChI=1S/C13H21NO3.ClH/c1-4-8(2)13(16)12(14)11-9(15)6-5-7-10(11)17-3;/h5-8,12-13,15-16H,4,14H2,1-3H3;1H/t8?,12-,13+;/m0./s1 |
| InChIKey | UUGDCCNMUXUHIE-FGEDJMNYSA-N |
| XLogP | 2.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|