C14H22ClNO3 — CID 171266126
2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-3-methoxyphenol;hydrochloride (PubChem CID 171266126) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-3-methoxyphenol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-3-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171266126 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-3-methoxyphenol;hydrochloride |
| SMILES | COc1cccc(O)c1[C@@H](N)[C@@H](O)C1CCCC1.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-18-11-8-4-7-10(16)12(11)13(15)14(17)9-5-2-3-6-9;/h4,7-9,13-14,16-17H,2-3,5-6,15H2,1H3;1H/t13-,14+;/m1./s1 |
| InChIKey | SQKMODHCJKXPNR-DFQHDRSWSA-N |
| XLogP | 2.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|