C14H21NO2 — CID 171235941
2-[(S)-amino(cyclohexyl)methyl]-3-methoxyphenol (PubChem CID 171235941) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-[(S)-amino(cyclohexyl)methyl]-3-methoxyphenol.
| Compound Name | 2-[(S)-amino(cyclohexyl)methyl]-3-methoxyphenol |
|---|---|
| PubChem CID | 171235941 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-[(S)-amino(cyclohexyl)methyl]-3-methoxyphenol |
| SMILES | COc1cccc(O)c1[C@@H](N)C1CCCCC1 |
| InChI | InChI=1S/C14H21NO2/c1-17-12-9-5-8-11(16)13(12)14(15)10-6-3-2-4-7-10/h5,8-10,14,16H,2-4,6-7,15H2,1H3/t14-/m0/s1 |
| InChIKey | BIKVKWMDIPLLLL-AWEZNQCLSA-N |
| XLogP | 2.98 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|