C12H18ClNO2 — CID 171220722
(S)-cyclopropyl-(2,6-dimethoxyphenyl)methanamine;hydrochloride (PubChem CID 171220722) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is (S)-cyclopropyl-(2,6-dimethoxyphenyl)methanamine;hydrochloride.
| Compound Name | (S)-cyclopropyl-(2,6-dimethoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171220722 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (S)-cyclopropyl-(2,6-dimethoxyphenyl)methanamine;hydrochloride |
| SMILES | COc1cccc(OC)c1[C@@H](N)C1CC1.Cl |
| InChI | InChI=1S/C12H17NO2.ClH/c1-14-9-4-3-5-10(15-2)11(9)12(13)8-6-7-8;/h3-5,8,12H,6-7,13H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | DFGWCMBNIWGHCG-YDALLXLXSA-N |
| XLogP | 2.54 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |