C15H18ClNO — CID 171212946
(R)-cyclopropyl-(2-methoxynaphthalen-1-yl)methanamine;hydrochloride (PubChem CID 171212946) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is (R)-cyclopropyl-(2-methoxynaphthalen-1-yl)methanamine;hydrochloride.
| Compound Name | (R)-cyclopropyl-(2-methoxynaphthalen-1-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171212946 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (R)-cyclopropyl-(2-methoxynaphthalen-1-yl)methanamine;hydrochloride |
| SMILES | COc1ccc2ccccc2c1[C@H](N)C1CC1.Cl |
| InChI | InChI=1S/C15H17NO.ClH/c1-17-13-9-8-10-4-2-3-5-12(10)14(13)15(16)11-6-7-11;/h2-5,8-9,11,15H,6-7,16H2,1H3;1H/t15-;/m1./s1 |
| InChIKey | XGDHTPNNJBWLJL-XFULWGLBSA-N |
| XLogP | 3.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |