C17H22ClNO — CID 171233021
(S)-cyclobutyl-(2-ethoxynaphthalen-1-yl)methanamine;hydrochloride (PubChem CID 171233021) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is (S)-cyclobutyl-(2-ethoxynaphthalen-1-yl)methanamine;hydrochloride.
| Compound Name | (S)-cyclobutyl-(2-ethoxynaphthalen-1-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171233021 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (S)-cyclobutyl-(2-ethoxynaphthalen-1-yl)methanamine;hydrochloride |
| SMILES | CCOc1ccc2ccccc2c1[C@@H](N)C1CCC1.Cl |
| InChI | InChI=1S/C17H21NO.ClH/c1-2-19-15-11-10-12-6-3-4-9-14(12)16(15)17(18)13-7-5-8-13;/h3-4,6,9-11,13,17H,2,5,7-8,18H2,1H3;1H/t17-;/m0./s1 |
| InChIKey | KHHXDKCGHRCAOK-LMOVPXPDSA-N |
| XLogP | 4.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |