C15H18ClN — CID 171212042
(R)-cyclobutyl(naphthalen-1-yl)methanamine;hydrochloride (PubChem CID 171212042) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is (R)-cyclobutyl(naphthalen-1-yl)methanamine;hydrochloride.
| Compound Name | (R)-cyclobutyl(naphthalen-1-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171212042 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (R)-cyclobutyl(naphthalen-1-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cccc2ccccc12)C1CCC1 |
| InChI | InChI=1S/C15H17N.ClH/c16-15(12-7-3-8-12)14-10-4-6-11-5-1-2-9-13(11)14;/h1-2,4-6,9-10,12,15H,3,7-8,16H2;1H/t15-;/m1./s1 |
| InChIKey | ACITXWMJBNGFIB-XFULWGLBSA-N |
| XLogP | 4.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |