C15H20ClNO2 — CID 171213425
(3R)-3-amino-3-(2-ethoxynaphthalen-1-yl)propan-1-ol;hydrochloride (PubChem CID 171213425) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is (3R)-3-amino-3-(2-ethoxynaphthalen-1-yl)propan-1-ol;hydrochloride.
| Compound Name | (3R)-3-amino-3-(2-ethoxynaphthalen-1-yl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171213425 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (3R)-3-amino-3-(2-ethoxynaphthalen-1-yl)propan-1-ol;hydrochloride |
| SMILES | CCOc1ccc2ccccc2c1[C@H](N)CCO.Cl |
| InChI | InChI=1S/C15H19NO2.ClH/c1-2-18-14-8-7-11-5-3-4-6-12(11)15(14)13(16)9-10-17;/h3-8,13,17H,2,9-10,16H2,1H3;1H/t13-;/m1./s1 |
| InChIKey | CSDTZWLKQDCCDY-BTQNPOSSSA-N |
| XLogP | 3.04 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |