C16H22ClNO2 — CID 171213427
(4R)-4-amino-4-(2-ethoxynaphthalen-1-yl)butan-1-ol;hydrochloride (PubChem CID 171213427) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is (4R)-4-amino-4-(2-ethoxynaphthalen-1-yl)butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-amino-4-(2-ethoxynaphthalen-1-yl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171213427 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (4R)-4-amino-4-(2-ethoxynaphthalen-1-yl)butan-1-ol;hydrochloride |
| SMILES | CCOc1ccc2ccccc2c1[C@H](N)CCCO.Cl |
| InChI | InChI=1S/C16H21NO2.ClH/c1-2-19-15-10-9-12-6-3-4-7-13(12)16(15)14(17)8-5-11-18;/h3-4,6-7,9-10,14,18H,2,5,8,11,17H2,1H3;1H/t14-;/m1./s1 |
| InChIKey | VDTXCUFDZKSUEY-PFEQFJNWSA-N |
| XLogP | 3.43 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |