C15H21ClN2O — CID 171213373
(1R)-1-(2-ethoxynaphthalen-1-yl)propane-1,3-diamine;hydrochloride (PubChem CID 171213373) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is (1R)-1-(2-ethoxynaphthalen-1-yl)propane-1,3-diamine;hydrochloride.
| Compound Name | (1R)-1-(2-ethoxynaphthalen-1-yl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 171213373 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1R)-1-(2-ethoxynaphthalen-1-yl)propane-1,3-diamine;hydrochloride |
| SMILES | CCOc1ccc2ccccc2c1[C@H](N)CCN.Cl |
| InChI | InChI=1S/C15H20N2O.ClH/c1-2-18-14-8-7-11-5-3-4-6-12(11)15(14)13(17)9-10-16;/h3-8,13H,2,9-10,16-17H2,1H3;1H/t13-;/m1./s1 |
| InChIKey | DISVZEXKURCBGU-BTQNPOSSSA-N |
| XLogP | 3.01 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |