C16H23ClN2O — CID 171212923
(1R)-1-(2-methoxynaphthalen-1-yl)pentane-1,5-diamine;hydrochloride (PubChem CID 171212923) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is (1R)-1-(2-methoxynaphthalen-1-yl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-(2-methoxynaphthalen-1-yl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171212923 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (1R)-1-(2-methoxynaphthalen-1-yl)pentane-1,5-diamine;hydrochloride |
| SMILES | COc1ccc2ccccc2c1[C@H](N)CCCCN.Cl |
| InChI | InChI=1S/C16H22N2O.ClH/c1-19-15-10-9-12-6-2-3-7-13(12)16(15)14(18)8-4-5-11-17;/h2-3,6-7,9-10,14H,4-5,8,11,17-18H2,1H3;1H/t14-;/m1./s1 |
| InChIKey | HQBUEAFBUNCWCJ-PFEQFJNWSA-N |
| XLogP | 3.40 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|