C19H23ClN2 — CID 171197562
(1R)-1-anthracen-9-ylpentane-1,5-diamine;hydrochloride (PubChem CID 171197562) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is (1R)-1-anthracen-9-ylpentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-anthracen-9-ylpentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171197562 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (1R)-1-anthracen-9-ylpentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H22N2.ClH/c20-12-6-5-11-18(21)19-16-9-3-1-7-14(16)13-15-8-2-4-10-17(15)19;/h1-4,7-10,13,18H,5-6,11-12,20-21H2;1H/t18-;/m1./s1 |
| InChIKey | JZXGNYYEAAUKES-GMUIIQOCSA-N |
| XLogP | 4.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|