C13H22N2 — CID 171223884
(1S)-1-(2,6-dimethylphenyl)pentane-1,5-diamine (PubChem CID 171223884) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (1S)-1-(2,6-dimethylphenyl)pentane-1,5-diamine.
| Compound Name | (1S)-1-(2,6-dimethylphenyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171223884 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (1S)-1-(2,6-dimethylphenyl)pentane-1,5-diamine |
| SMILES | Cc1cccc(C)c1[C@@H](N)CCCCN |
| InChI | InChI=1S/C13H22N2/c1-10-6-5-7-11(2)13(10)12(15)8-3-4-9-14/h5-7,12H,3-4,8-9,14-15H2,1-2H3/t12-/m0/s1 |
| InChIKey | VXMRPQREKALSDB-LBPRGKRZSA-N |
| XLogP | 2.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|