C10H14FN — CID 130061517
1-(2,6-dimethylphenyl)-2-fluoroethanamine (PubChem CID 130061517) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2-fluoroethanamine.
| Compound Name | 1-(2,6-dimethylphenyl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 130061517 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2-fluoroethanamine |
| SMILES | Cc1cccc(C)c1C(N)CF |
| InChI | InChI=1S/C10H14FN/c1-7-4-3-5-8(2)10(7)9(12)6-11/h3-5,9H,6,12H2,1-2H3 |
| InChIKey | VOQXEYXVABNMGX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |