C9H12ClF2NO — CID 171253539
2-[(1R)-1-amino-2-fluoroethyl]-6-fluoro-3-methylphenol;hydrochloride (PubChem CID 171253539) has the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2-fluoroethyl]-6-fluoro-3-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2-fluoroethyl]-6-fluoro-3-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171253539 |
| Molecular Formula | C9H12ClF2NO |
| Molecular Weight | 223.65 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-[(1R)-1-amino-2-fluoroethyl]-6-fluoro-3-methylphenol;hydrochloride |
| SMILES | Cc1ccc(F)c(O)c1[C@@H](N)CF.Cl |
| InChI | InChI=1S/C9H11F2NO.ClH/c1-5-2-3-6(11)9(13)8(5)7(12)4-10;/h2-3,7,13H,4,12H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | XTLVEVBMIQYDRZ-FJXQXJEOSA-N |
| XLogP | 2.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|