C12H19ClFNO2 — CID 171253555
2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-6-fluoro-3-methylphenol;hydrochloride (PubChem CID 171253555) has the molecular formula C12H19ClFNO2 and a molecular weight of 263.74 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-6-fluoro-3-methylphenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-6-fluoro-3-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171253555 |
| Molecular Formula | C12H19ClFNO2 |
| Molecular Weight | 263.74 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-6-fluoro-3-methylphenol;hydrochloride |
| SMILES | Cc1ccc(F)c(O)c1[C@@H](N)C(C)(C)CO.Cl |
| InChI | InChI=1S/C12H18FNO2.ClH/c1-7-4-5-8(13)10(16)9(7)11(14)12(2,3)6-15;/h4-5,11,15-16H,6,14H2,1-3H3;1H/t11-;/m1./s1 |
| InChIKey | MAAXZLHKGFGZFS-RFVHGSKJSA-N |
| XLogP | 2.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|