C12H19ClFNO — CID 171256902
2-[(1R)-1-amino-3-methylbutyl]-6-fluoro-3-methylphenol;hydrochloride (PubChem CID 171256902) has the molecular formula C12H19ClFNO and a molecular weight of 247.74 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-methylbutyl]-6-fluoro-3-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-methylbutyl]-6-fluoro-3-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171256902 |
| Molecular Formula | C12H19ClFNO |
| Molecular Weight | 247.74 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-[(1R)-1-amino-3-methylbutyl]-6-fluoro-3-methylphenol;hydrochloride |
| SMILES | Cc1ccc(F)c(O)c1[C@H](N)CC(C)C.Cl |
| InChI | InChI=1S/C12H18FNO.ClH/c1-7(2)6-10(14)11-8(3)4-5-9(13)12(11)15;/h4-5,7,10,15H,6,14H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | SQXXDFVCMPXCIH-HNCPQSOCSA-N |
| XLogP | 3.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|