C10H14FNO2 — CID 130655554
2-[(1S,2R)-1-amino-2-hydroxypropyl]-6-fluoro-3-methylphenol (PubChem CID 130655554) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxypropyl]-6-fluoro-3-methylphenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxypropyl]-6-fluoro-3-methylphenol |
|---|---|
| PubChem CID | 130655554 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxypropyl]-6-fluoro-3-methylphenol |
| SMILES | Cc1ccc(F)c(O)c1[C@H](N)[C@@H](C)O |
| InChI | InChI=1S/C10H14FNO2/c1-5-3-4-7(11)10(14)8(5)9(12)6(2)13/h3-4,6,9,13-14H,12H2,1-2H3/t6-,9-/m1/s1 |
| InChIKey | JFNILVYSARRBLT-HZGVNTEJSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|