C9H9FN2O — CID 130673937
(2S)-2-amino-2-(3-fluoro-2-hydroxy-6-methylphenyl)acetonitrile (PubChem CID 130673937) has the molecular formula C9H9FN2O and a molecular weight of 180.18 g/mol. Its IUPAC name is (2S)-2-amino-2-(3-fluoro-2-hydroxy-6-methylphenyl)acetonitrile.
| Compound Name | (2S)-2-amino-2-(3-fluoro-2-hydroxy-6-methylphenyl)acetonitrile |
|---|---|
| PubChem CID | 130673937 |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | (2S)-2-amino-2-(3-fluoro-2-hydroxy-6-methylphenyl)acetonitrile |
| SMILES | Cc1ccc(F)c(O)c1[C@H](N)C#N |
| InChI | InChI=1S/C9H9FN2O/c1-5-2-3-6(10)9(13)8(5)7(12)4-11/h2-3,7,13H,12H2,1H3/t7-/m1/s1 |
| InChIKey | ULMWSCMHUNSUST-SSDOTTSWSA-N |
| XLogP | 1.36 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|