C10H12FNO — CID 130692924
2-[(1S)-1-aminoprop-2-enyl]-6-fluoro-3-methylphenol (PubChem CID 130692924) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 2-[(1S)-1-aminoprop-2-enyl]-6-fluoro-3-methylphenol.
| Compound Name | 2-[(1S)-1-aminoprop-2-enyl]-6-fluoro-3-methylphenol |
|---|---|
| PubChem CID | 130692924 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-[(1S)-1-aminoprop-2-enyl]-6-fluoro-3-methylphenol |
| SMILES | C=C[C@H](N)c1c(C)ccc(F)c1O |
| InChI | InChI=1S/C10H12FNO/c1-3-8(12)9-6(2)4-5-7(11)10(9)13/h3-5,8,13H,1,12H2,2H3/t8-/m0/s1 |
| InChIKey | ROMNDKIPOAVKJG-QMMMGPOBSA-N |
| XLogP | 2.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|