C11H17NO2 — CID 130059979
2-(1-amino-2-hydroxypropyl)-3,6-dimethylphenol (PubChem CID 130059979) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(1-amino-2-hydroxypropyl)-3,6-dimethylphenol.
| Compound Name | 2-(1-amino-2-hydroxypropyl)-3,6-dimethylphenol |
|---|---|
| PubChem CID | 130059979 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(1-amino-2-hydroxypropyl)-3,6-dimethylphenol |
| SMILES | Cc1ccc(C)c(C(N)C(C)O)c1O |
| InChI | InChI=1S/C11H17NO2/c1-6-4-5-7(2)11(14)9(6)10(12)8(3)13/h4-5,8,10,13-14H,12H2,1-3H3 |
| InChIKey | MXQGVJQWLYVSSV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|