C9H12F2N2O — CID 131219013
6-amino-2-[(1S)-1-amino-2,2-difluoroethyl]-3-methylphenol (PubChem CID 131219013) has the molecular formula C9H12F2N2O and a molecular weight of 202.20 g/mol. Its IUPAC name is 6-amino-2-[(1S)-1-amino-2,2-difluoroethyl]-3-methylphenol.
| Compound Name | 6-amino-2-[(1S)-1-amino-2,2-difluoroethyl]-3-methylphenol |
|---|---|
| PubChem CID | 131219013 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 6-amino-2-[(1S)-1-amino-2,2-difluoroethyl]-3-methylphenol |
| SMILES | Cc1ccc(N)c(O)c1[C@H](N)C(F)F |
| InChI | InChI=1S/C9H12F2N2O/c1-4-2-3-5(12)8(14)6(4)7(13)9(10)11/h2-3,7,9,14H,12-13H2,1H3/t7-/m0/s1 |
| InChIKey | ZYEYNWVLDUEAAQ-ZETCQYMHSA-N |
| XLogP | 1.55 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|