C15H16ClF3N2O2 — CID 171256940
6-amino-2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-methylphenol;hydrochloride (PubChem CID 171256940) has the molecular formula C15H16ClF3N2O2 and a molecular weight of 348.75 g/mol. Its IUPAC name is 6-amino-2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-methylphenol;hydrochloride.
| Compound Name | 6-amino-2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171256940 |
| Molecular Formula | C15H16ClF3N2O2 |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 6-amino-2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-methylphenol;hydrochloride |
| SMILES | Cc1ccc(N)c(O)c1[C@H](N)c1ccc(OC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C15H15F3N2O2.ClH/c1-8-2-7-11(19)14(21)12(8)13(20)9-3-5-10(6-4-9)22-15(16,17)18;/h2-7,13,21H,19-20H2,1H3;1H/t13-;/m1./s1 |
| InChIKey | RVPZJCMKZJQPHX-BTQNPOSSSA-N |
| XLogP | 3.65 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|