C19H17ClF3NO — CID 171242636
(S)-(4-methylnaphthalen-1-yl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride (PubChem CID 171242636) has the molecular formula C19H17ClF3NO and a molecular weight of 367.80 g/mol. Its IUPAC name is (S)-(4-methylnaphthalen-1-yl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride.
| Compound Name | (S)-(4-methylnaphthalen-1-yl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171242636 |
| Molecular Formula | C19H17ClF3NO |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (S)-(4-methylnaphthalen-1-yl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
| SMILES | Cc1ccc([C@@H](N)c2ccc(OC(F)(F)F)cc2)c2ccccc12.Cl |
| InChI | InChI=1S/C19H16F3NO.ClH/c1-12-6-11-17(16-5-3-2-4-15(12)16)18(23)13-7-9-14(10-8-13)24-19(20,21)22;/h2-11,18H,23H2,1H3;1H/t18-;/m0./s1 |
| InChIKey | QAGRNKHZMKYNBU-FERBBOLQSA-N |
| XLogP | 5.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |