C15H15ClF3NO3 — CID 171239810
2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-methoxyphenol;hydrochloride (PubChem CID 171239810) has the molecular formula C15H15ClF3NO3 and a molecular weight of 349.74 g/mol. Its IUPAC name is 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-methoxyphenol;hydrochloride.
| Compound Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171239810 |
| Molecular Formula | C15H15ClF3NO3 |
| Molecular Weight | 349.74 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-methoxyphenol;hydrochloride |
| SMILES | COc1ccc([C@@H](N)c2ccc(OC(F)(F)F)cc2)c(O)c1.Cl |
| InChI | InChI=1S/C15H14F3NO3.ClH/c1-21-11-6-7-12(13(20)8-11)14(19)9-2-4-10(5-3-9)22-15(16,17)18;/h2-8,14,20H,19H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | BSQRHCUJHAKZFK-UQKRIMTDSA-N |
| XLogP | 3.77 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|