C15H14F3NO3 — CID 171246523
2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-methoxyphenol (PubChem CID 171246523) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-methoxyphenol.
| Compound Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 171246523 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-methoxyphenol |
| SMILES | COc1ccc([C@H](N)c2ccc(OC(F)(F)F)cc2)c(O)c1 |
| InChI | InChI=1S/C15H14F3NO3/c1-21-11-6-7-12(13(20)8-11)14(19)9-2-4-10(5-3-9)22-15(16,17)18/h2-8,14,20H,19H2,1H3/t14-/m1/s1 |
| InChIKey | CFSCPRUDQFLNSQ-CQSZACIVSA-N |
| XLogP | 3.35 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|