C14H12BrClF3NO2 — CID 171247977
2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-bromophenol;hydrochloride (PubChem CID 171247977) has the molecular formula C14H12BrClF3NO2 and a molecular weight of 398.61 g/mol. Its IUPAC name is 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-bromophenol;hydrochloride.
| Compound Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-bromophenol;hydrochloride |
|---|---|
| PubChem CID | 171247977 |
| Molecular Formula | C14H12BrClF3NO2 |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-bromophenol;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc(OC(F)(F)F)cc1)c1ccc(Br)cc1O |
| InChI | InChI=1S/C14H11BrF3NO2.ClH/c15-9-3-6-11(12(20)7-9)13(19)8-1-4-10(5-2-8)21-14(16,17)18;/h1-7,13,20H,19H2;1H/t13-;/m1./s1 |
| InChIKey | MYVSZSYVSVUXTM-BTQNPOSSSA-N |
| XLogP | 4.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|