C14H11Br2F3N2O — CID 171246069
2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4,6-dibromoaniline (PubChem CID 171246069) has the molecular formula C14H11Br2F3N2O and a molecular weight of 440.06 g/mol. Its IUPAC name is 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4,6-dibromoaniline.
| Compound Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4,6-dibromoaniline |
|---|---|
| PubChem CID | 171246069 |
| Molecular Formula | C14H11Br2F3N2O |
| Molecular Weight | 440.06 g/mol |
| Exact Mass | 437.92 |
| IUPAC Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4,6-dibromoaniline |
| SMILES | Nc1c(Br)cc(Br)cc1[C@H](N)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11Br2F3N2O/c15-8-5-10(13(21)11(16)6-8)12(20)7-1-3-9(4-2-7)22-14(17,18)19/h1-6,12H,20-21H2/t12-/m1/s1 |
| InChIKey | DXDKXFDYUPMGGP-GFCCVEGCSA-N |
| XLogP | 4.74 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.06 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|