C15H11BrF3NO4 — CID 171258148
3-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-bromo-4-hydroxybenzoic acid (PubChem CID 171258148) has the molecular formula C15H11BrF3NO4 and a molecular weight of 406.15 g/mol. Its IUPAC name is 3-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-bromo-4-hydroxybenzoic acid.
| Compound Name | 3-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-bromo-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171258148 |
| Molecular Formula | C15H11BrF3NO4 |
| Molecular Weight | 406.15 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 3-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-5-bromo-4-hydroxybenzoic acid |
| SMILES | N[C@H](c1ccc(OC(F)(F)F)cc1)c1cc(C(=O)O)cc(Br)c1O |
| InChI | InChI=1S/C15H11BrF3NO4/c16-11-6-8(14(22)23)5-10(13(11)21)12(20)7-1-3-9(4-2-7)24-15(17,18)19/h1-6,12,21H,20H2,(H,22,23)/t12-/m1/s1 |
| InChIKey | DALDKEMJDIUVAO-GFCCVEGCSA-N |
| XLogP | 3.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.15 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|