C14H10BrF3N2O4 — CID 171251273
2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-6-nitrophenol (PubChem CID 171251273) has the molecular formula C14H10BrF3N2O4 and a molecular weight of 407.14 g/mol. Its IUPAC name is 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-6-nitrophenol.
| Compound Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-6-nitrophenol |
|---|---|
| PubChem CID | 171251273 |
| Molecular Formula | C14H10BrF3N2O4 |
| Molecular Weight | 407.14 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 2-[(R)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-6-nitrophenol |
| SMILES | N[C@H](c1ccc(OC(F)(F)F)cc1)c1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C14H10BrF3N2O4/c15-8-5-10(13(21)11(6-8)20(22)23)12(19)7-1-3-9(4-2-7)24-14(16,17)18/h1-6,12,21H,19H2/t12-/m1/s1 |
| InChIKey | FUTZNNOTPWSJID-GFCCVEGCSA-N |
| XLogP | 4.01 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.14 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|