C16H16ClF3N2O5 — CID 171244129
(S)-(4,5-dimethoxy-2-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride (PubChem CID 171244129) has the molecular formula C16H16ClF3N2O5 and a molecular weight of 408.76 g/mol. Its IUPAC name is (S)-(4,5-dimethoxy-2-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride.
| Compound Name | (S)-(4,5-dimethoxy-2-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171244129 |
| Molecular Formula | C16H16ClF3N2O5 |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | (S)-(4,5-dimethoxy-2-nitrophenyl)-[4-(trifluoromethoxy)phenyl]methanamine;hydrochloride |
| SMILES | COc1cc([C@@H](N)c2ccc(OC(F)(F)F)cc2)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C16H15F3N2O5.ClH/c1-24-13-7-11(12(21(22)23)8-14(13)25-2)15(20)9-3-5-10(6-4-9)26-16(17,18)19;/h3-8,15H,20H2,1-2H3;1H/t15-;/m0./s1 |
| InChIKey | SARHECKIQPZLPE-RSAXXLAASA-N |
| XLogP | 3.98 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|