C16H17NO6 — CID 4598455
(4,5-dimethoxy-2-nitrophenyl)-(4-methoxyphenyl)methanol (PubChem CID 4598455) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)-(4-methoxyphenyl)methanol.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 4598455 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2cc(OC)c(OC)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17NO6/c1-21-11-6-4-10(5-7-11)16(18)12-8-14(22-2)15(23-3)9-13(12)17(19)20/h4-9,16,18H,1-3H3 |
| InChIKey | OKQAUKWXEQDHKU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|